C19H30N4O — CID 78880682
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(8-tricyclo[5.2.1.02,6]decanyl)urea (PubChem CID 78880682) has the molecular formula C19H30N4O and a molecular weight of 330.48 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(8-tricyclo[5.2.1.02,6]decanyl)urea.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(8-tricyclo[5.2.1.02,6]decanyl)urea |
|---|---|
| PubChem CID | 78880682 |
| Molecular Formula | C19H30N4O |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(8-tricyclo[5.2.1.02,6]decanyl)urea |
| SMILES | Cc1cc(C)n(CCCNC(=O)NC2CC3CC2C2CCCC32)n1 |
| InChI | InChI=1S/C19H30N4O/c1-12-9-13(2)23(22-12)8-4-7-20-19(24)21-18-11-14-10-17(18)16-6-3-5-15(14)16/h9,14-18H,3-8,10-11H2,1-2H3,(H2,20,21,24) |
| InChIKey | HTQWLOCLSLSKDI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|