C11H13N5O3 — CID 112733407
N-[6-(2-methoxyethoxy)-3-pyridinyl]-2H-triazole-4-carboxamide (PubChem CID 112733407) has the molecular formula C11H13N5O3 and a molecular weight of 263.26 g/mol. Its IUPAC name is N-[6-(2-methoxyethoxy)-3-pyridinyl]-2H-triazole-4-carboxamide.
| Compound Name | N-[6-(2-methoxyethoxy)-3-pyridinyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 112733407 |
| Molecular Formula | C11H13N5O3 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | N-[6-(2-methoxyethoxy)-3-pyridinyl]-2H-triazole-4-carboxamide |
| SMILES | COCCOc1ccc(NC(=O)c2cn[nH]n2)cn1 |
| InChI | InChI=1S/C11H13N5O3/c1-18-4-5-19-10-3-2-8(6-12-10)14-11(17)9-7-13-16-15-9/h2-3,6-7H,4-5H2,1H3,(H,14,17)(H,13,15,16) |
| InChIKey | BAXQBVCCSJCUPI-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|