C16H25N3O4 — CID 97255262
1-[6-(2-methoxyethoxy)-3-pyridinyl]-3-[[(2S,4S)-2-methyloxan-4-yl]methyl]urea (PubChem CID 97255262) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is 1-[6-(2-methoxyethoxy)-3-pyridinyl]-3-[[(2S,4S)-2-methyloxan-4-yl]methyl]urea.
| Compound Name | 1-[6-(2-methoxyethoxy)-3-pyridinyl]-3-[[(2S,4S)-2-methyloxan-4-yl]methyl]urea |
|---|---|
| PubChem CID | 97255262 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 1-[6-(2-methoxyethoxy)-3-pyridinyl]-3-[[(2S,4S)-2-methyloxan-4-yl]methyl]urea |
| SMILES | COCCOc1ccc(NC(=O)NC[C@H]2CCO[C@@H](C)C2)cn1 |
| InChI | InChI=1S/C16H25N3O4/c1-12-9-13(5-6-22-12)10-18-16(20)19-14-3-4-15(17-11-14)23-8-7-21-2/h3-4,11-13H,5-10H2,1-2H3,(H2,18,19,20)/t12-,13-/m0/s1 |
| InChIKey | DLTZHTDKUOCAPZ-STQMWFEESA-N |
| XLogP | 2.04 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|