C12H17N3O4S — CID 47220631
1-[(1,1-dioxothiolan-3-yl)methyl]-3-(6-methoxy-3-pyridinyl)urea (PubChem CID 47220631) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is 1-[(1,1-dioxothiolan-3-yl)methyl]-3-(6-methoxy-3-pyridinyl)urea.
| Compound Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-3-(6-methoxy-3-pyridinyl)urea |
|---|---|
| PubChem CID | 47220631 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-3-(6-methoxy-3-pyridinyl)urea |
| SMILES | COc1ccc(NC(=O)NCC2CCS(=O)(=O)C2)cn1 |
| InChI | InChI=1S/C12H17N3O4S/c1-19-11-3-2-10(7-13-11)15-12(16)14-6-9-4-5-20(17,18)8-9/h2-3,7,9H,4-6,8H2,1H3,(H2,14,15,16) |
| InChIKey | JGFGQJRFYOOLDO-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |