C13H19N3O3S — CID 62132159
1-[4-(aminomethyl)phenyl]-3-[(1,1-dioxothiolan-3-yl)methyl]urea (PubChem CID 62132159) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is 1-[4-(aminomethyl)phenyl]-3-[(1,1-dioxothiolan-3-yl)methyl]urea.
| Compound Name | 1-[4-(aminomethyl)phenyl]-3-[(1,1-dioxothiolan-3-yl)methyl]urea |
|---|---|
| PubChem CID | 62132159 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 1-[4-(aminomethyl)phenyl]-3-[(1,1-dioxothiolan-3-yl)methyl]urea |
| SMILES | NCc1ccc(NC(=O)NCC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C13H19N3O3S/c14-7-10-1-3-12(4-2-10)16-13(17)15-8-11-5-6-20(18,19)9-11/h1-4,11H,5-9,14H2,(H2,15,16,17) |
| InChIKey | AKLBJHZMMYYENJ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |