C9H14N4O3S — CID 95129992
1-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-3-(1H-pyrazol-4-yl)urea (PubChem CID 95129992) has the molecular formula C9H14N4O3S and a molecular weight of 258.30 g/mol. Its IUPAC name is 1-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-3-(1H-pyrazol-4-yl)urea.
| Compound Name | 1-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-3-(1H-pyrazol-4-yl)urea |
|---|---|
| PubChem CID | 95129992 |
| Molecular Formula | C9H14N4O3S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 1-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-3-(1H-pyrazol-4-yl)urea |
| SMILES | O=C(NC[C@H]1CCS(=O)(=O)C1)Nc1cn[nH]c1 |
| InChI | InChI=1S/C9H14N4O3S/c14-9(13-8-4-11-12-5-8)10-3-7-1-2-17(15,16)6-7/h4-5,7H,1-3,6H2,(H,11,12)(H2,10,13,14)/t7-/m1/s1 |
| InChIKey | ZCHNJVYJUXKTEI-SSDOTTSWSA-N |
| XLogP | -0.03 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |