C15H18N4O3S — CID 74240313
1-[(1,1-dioxothiolan-3-yl)methyl]-3-[3-(1H-imidazol-5-yl)phenyl]urea (PubChem CID 74240313) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is 1-[(1,1-dioxothiolan-3-yl)methyl]-3-[3-(1H-imidazol-5-yl)phenyl]urea.
| Compound Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-3-[3-(1H-imidazol-5-yl)phenyl]urea |
|---|---|
| PubChem CID | 74240313 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-3-[3-(1H-imidazol-5-yl)phenyl]urea |
| SMILES | O=C(NCC1CCS(=O)(=O)C1)Nc1cccc(-c2cnc[nH]2)c1 |
| InChI | InChI=1S/C15H18N4O3S/c20-15(17-7-11-4-5-23(21,22)9-11)19-13-3-1-2-12(6-13)14-8-16-10-18-14/h1-3,6,8,10-11H,4-5,7,9H2,(H,16,18)(H2,17,19,20) |
| InChIKey | NMWDSVUQXJHSMJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |