C15H17N3O3S — CID 95126841
1-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-3-quinolin-3-ylurea (PubChem CID 95126841) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is 1-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-3-quinolin-3-ylurea.
| Compound Name | 1-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-3-quinolin-3-ylurea |
|---|---|
| PubChem CID | 95126841 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 1-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-3-quinolin-3-ylurea |
| SMILES | O=C(NC[C@H]1CCS(=O)(=O)C1)Nc1cnc2ccccc2c1 |
| InChI | InChI=1S/C15H17N3O3S/c19-15(17-8-11-5-6-22(20,21)10-11)18-13-7-12-3-1-2-4-14(12)16-9-13/h1-4,7,9,11H,5-6,8,10H2,(H2,17,18,19)/t11-/m1/s1 |
| InChIKey | YJWBJOOBTJJMSA-LLVKDONJSA-N |
| XLogP | 1.79 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |