C14H17N5O3S — CID 94179429
1-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-3-(6-pyrazol-1-yl-3-pyridinyl)urea (PubChem CID 94179429) has the molecular formula C14H17N5O3S and a molecular weight of 335.39 g/mol. Its IUPAC name is 1-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-3-(6-pyrazol-1-yl-3-pyridinyl)urea.
| Compound Name | 1-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-3-(6-pyrazol-1-yl-3-pyridinyl)urea |
|---|---|
| PubChem CID | 94179429 |
| Molecular Formula | C14H17N5O3S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 1-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-3-(6-pyrazol-1-yl-3-pyridinyl)urea |
| SMILES | O=C(NC[C@H]1CCS(=O)(=O)C1)Nc1ccc(-n2cccn2)nc1 |
| InChI | InChI=1S/C14H17N5O3S/c20-14(16-8-11-4-7-23(21,22)10-11)18-12-2-3-13(15-9-12)19-6-1-5-17-19/h1-3,5-6,9,11H,4,7-8,10H2,(H2,16,18,20)/t11-/m1/s1 |
| InChIKey | XQHHTEJQWMVBKC-LLVKDONJSA-N |
| XLogP | 0.82 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |