C17H21N3O2 — CID 97255277
1-[[(2R,4S)-2-methyloxan-4-yl]methyl]-3-quinolin-8-ylurea (PubChem CID 97255277) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 1-[[(2R,4S)-2-methyloxan-4-yl]methyl]-3-quinolin-8-ylurea.
| Compound Name | 1-[[(2R,4S)-2-methyloxan-4-yl]methyl]-3-quinolin-8-ylurea |
|---|---|
| PubChem CID | 97255277 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 1-[[(2R,4S)-2-methyloxan-4-yl]methyl]-3-quinolin-8-ylurea |
| SMILES | C[C@@H]1C[C@@H](CNC(=O)Nc2cccc3cccnc23)CCO1 |
| InChI | InChI=1S/C17H21N3O2/c1-12-10-13(7-9-22-12)11-19-17(21)20-15-6-2-4-14-5-3-8-18-16(14)15/h2-6,8,12-13H,7,9-11H2,1H3,(H2,19,20,21)/t12-,13+/m1/s1 |
| InChIKey | GYPZAVPZEHQNCY-OLZOCXBDSA-N |
| XLogP | 3.17 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |