C27H24N4O2 — CID 135023876
2-N,3-N-di(quinolin-8-yl)bicyclo[2.2.1]heptane-2,3-dicarboxamide (PubChem CID 135023876) has the molecular formula C27H24N4O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is 2-N,3-N-di(quinolin-8-yl)bicyclo[2.2.1]heptane-2,3-dicarboxamide.
| Compound Name | 2-N,3-N-di(quinolin-8-yl)bicyclo[2.2.1]heptane-2,3-dicarboxamide |
|---|---|
| PubChem CID | 135023876 |
| Molecular Formula | C27H24N4O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 2-N,3-N-di(quinolin-8-yl)bicyclo[2.2.1]heptane-2,3-dicarboxamide |
| SMILES | O=C(Nc1cccc2cccnc12)C1C2CCC(C2)C1C(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C27H24N4O2/c32-26(30-20-9-1-5-16-7-3-13-28-24(16)20)22-18-11-12-19(15-18)23(22)27(33)31-21-10-2-6-17-8-4-14-29-25(17)21/h1-10,13-14,18-19,22-23H,11-12,15H2,(H,30,32)(H,31,33) |
| InChIKey | FFBMTMMEIORHLH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |