C28H26N2O — CID 177490344
cis-(2S,6R)-2,6-diphenyl-N-quinolin-8-ylcyclohexane-1-carboxamide (PubChem CID 177490344) has the molecular formula C28H26N2O and a molecular weight of 406.53 g/mol. Its IUPAC name is cis-(2S,6R)-2,6-diphenyl-N-quinolin-8-ylcyclohexane-1-carboxamide.
| Compound Name | cis-(2S,6R)-2,6-diphenyl-N-quinolin-8-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 177490344 |
| Molecular Formula | C28H26N2O |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | cis-(2S,6R)-2,6-diphenyl-N-quinolin-8-ylcyclohexane-1-carboxamide |
| SMILES | O=C(Nc1cccc2cccnc12)C1[C@@H](c2ccccc2)CCC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C28H26N2O/c31-28(30-25-18-7-14-22-15-9-19-29-27(22)25)26-23(20-10-3-1-4-11-20)16-8-17-24(26)21-12-5-2-6-13-21/h1-7,9-15,18-19,23-24,26H,8,16-17H2,(H,30,31)/t23-,24+,26? |
| InChIKey | UAWJGLRORKBISA-MAOIWGCQSA-N |
| XLogP | 6.54 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |