C26H29N3O3 — CID 170566687
tert-butyl (3R,4R)-4-phenyl-3-(quinolin-8-ylcarbamoyl)piperidine-1-carboxylate (PubChem CID 170566687) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is tert-butyl (3R,4R)-4-phenyl-3-(quinolin-8-ylcarbamoyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-4-phenyl-3-(quinolin-8-ylcarbamoyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170566687 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | tert-butyl (3R,4R)-4-phenyl-3-(quinolin-8-ylcarbamoyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](c2ccccc2)[C@@H](C(=O)Nc2cccc3cccnc23)C1 |
| InChI | InChI=1S/C26H29N3O3/c1-26(2,3)32-25(31)29-16-14-20(18-9-5-4-6-10-18)21(17-29)24(30)28-22-13-7-11-19-12-8-15-27-23(19)22/h4-13,15,20-21H,14,16-17H2,1-3H3,(H,28,30)/t20-,21-/m0/s1 |
| InChIKey | JKPBKIYOEZXACG-SFTDATJTSA-N |
| XLogP | 5.21 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |