C25H27N3O3 — CID 156839576
tert-butyl (3R,4S)-3-phenyl-4-(quinolin-8-ylcarbamoyl)pyrrolidine-1-carboxylate (PubChem CID 156839576) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is tert-butyl (3R,4S)-3-phenyl-4-(quinolin-8-ylcarbamoyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4S)-3-phenyl-4-(quinolin-8-ylcarbamoyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 156839576 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | tert-butyl (3R,4S)-3-phenyl-4-(quinolin-8-ylcarbamoyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C(=O)Nc2cccc3cccnc23)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C25H27N3O3/c1-25(2,3)31-24(30)28-15-19(17-9-5-4-6-10-17)20(16-28)23(29)27-21-13-7-11-18-12-8-14-26-22(18)21/h4-14,19-20H,15-16H2,1-3H3,(H,27,29)/t19-,20+/m0/s1 |
| InChIKey | SYCDYIHQEGXSEG-VQTJNVASSA-N |
| XLogP | 4.82 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |