C18H23N3O2 — CID 156685077
tert-butyl (3S)-3-(quinolin-5-ylamino)pyrrolidine-1-carboxylate (PubChem CID 156685077) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is tert-butyl (3S)-3-(quinolin-5-ylamino)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-(quinolin-5-ylamino)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 156685077 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | tert-butyl (3S)-3-(quinolin-5-ylamino)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](Nc2cccc3ncccc23)C1 |
| InChI | InChI=1S/C18H23N3O2/c1-18(2,3)23-17(22)21-11-9-13(12-21)20-16-8-4-7-15-14(16)6-5-10-19-15/h4-8,10,13,20H,9,11-12H2,1-3H3/t13-/m0/s1 |
| InChIKey | JQXLIWGXTBVEGQ-ZDUSSCGKSA-N |
| XLogP | 3.66 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |