C19H22F3N3O2 — CID 156685099
tert-butyl (3R)-3-[[8-(trifluoromethyl)quinolin-5-yl]amino]pyrrolidine-1-carboxylate (PubChem CID 156685099) has the molecular formula C19H22F3N3O2 and a molecular weight of 381.40 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[8-(trifluoromethyl)quinolin-5-yl]amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[8-(trifluoromethyl)quinolin-5-yl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 156685099 |
| Molecular Formula | C19H22F3N3O2 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | tert-butyl (3R)-3-[[8-(trifluoromethyl)quinolin-5-yl]amino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](Nc2ccc(C(F)(F)F)c3ncccc23)C1 |
| InChI | InChI=1S/C19H22F3N3O2/c1-18(2,3)27-17(26)25-10-8-12(11-25)24-15-7-6-14(19(20,21)22)16-13(15)5-4-9-23-16/h4-7,9,12,24H,8,10-11H2,1-3H3/t12-/m1/s1 |
| InChIKey | RMKOEUBFEPQZEK-GFCCVEGCSA-N |
| XLogP | 4.67 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |