C17H21BrN4O2 — CID 90387015
tert-butyl 3-[(6-bromo-1,7-naphthyridin-8-yl)amino]pyrrolidine-1-carboxylate (PubChem CID 90387015) has the molecular formula C17H21BrN4O2 and a molecular weight of 393.29 g/mol. Its IUPAC name is tert-butyl 3-[(6-bromo-1,7-naphthyridin-8-yl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(6-bromo-1,7-naphthyridin-8-yl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90387015 |
| Molecular Formula | C17H21BrN4O2 |
| Molecular Weight | 393.29 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | tert-butyl 3-[(6-bromo-1,7-naphthyridin-8-yl)amino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2nc(Br)cc3cccnc23)C1 |
| InChI | InChI=1S/C17H21BrN4O2/c1-17(2,3)24-16(23)22-8-6-12(10-22)20-15-14-11(5-4-7-19-14)9-13(18)21-15/h4-5,7,9,12H,6,8,10H2,1-3H3,(H,20,21) |
| InChIKey | HHLUJQHVHIZXMS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.29 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|