C14H20BrN3O2 — CID 71629441
tert-butyl (3R)-3-[(5-bromo-2-pyridinyl)amino]pyrrolidine-1-carboxylate (PubChem CID 71629441) has the molecular formula C14H20BrN3O2 and a molecular weight of 342.24 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(5-bromo-2-pyridinyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(5-bromo-2-pyridinyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71629441 |
| Molecular Formula | C14H20BrN3O2 |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | tert-butyl (3R)-3-[(5-bromo-2-pyridinyl)amino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](Nc2ccc(Br)cn2)C1 |
| InChI | InChI=1S/C14H20BrN3O2/c1-14(2,3)20-13(19)18-7-6-11(9-18)17-12-5-4-10(15)8-16-12/h4-5,8,11H,6-7,9H2,1-3H3,(H,16,17)/t11-/m1/s1 |
| InChIKey | WDLKNKVRVOUPRJ-LLVKDONJSA-N |
| XLogP | 3.27 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |