C13H20N4O2 — CID 71301820
tert-butyl (3S)-3-(pyrimidin-2-ylamino)pyrrolidine-1-carboxylate (PubChem CID 71301820) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is tert-butyl (3S)-3-(pyrimidin-2-ylamino)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-(pyrimidin-2-ylamino)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71301820 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | tert-butyl (3S)-3-(pyrimidin-2-ylamino)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](Nc2ncccn2)C1 |
| InChI | InChI=1S/C13H20N4O2/c1-13(2,3)19-12(18)17-8-5-10(9-17)16-11-14-6-4-7-15-11/h4,6-7,10H,5,8-9H2,1-3H3,(H,14,15,16)/t10-/m0/s1 |
| InChIKey | ACTDYKTUOFPSCD-JTQLQIEISA-N |
| XLogP | 1.90 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |