C13H22N4O2 — CID 177305921
tert-butyl 3-[(1-methylimidazol-2-yl)amino]pyrrolidine-1-carboxylate (PubChem CID 177305921) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is tert-butyl 3-[(1-methylimidazol-2-yl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(1-methylimidazol-2-yl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 177305921 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | tert-butyl 3-[(1-methylimidazol-2-yl)amino]pyrrolidine-1-carboxylate |
| SMILES | Cn1ccnc1NC1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C13H22N4O2/c1-13(2,3)19-12(18)17-7-5-10(9-17)15-11-14-6-8-16(11)4/h6,8,10H,5,7,9H2,1-4H3,(H,14,15) |
| InChIKey | OLRBVQRSEOLMLK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |