C12H19N3O2S — CID 71629653
tert-butyl 3-(1,3-thiazol-2-ylamino)pyrrolidine-1-carboxylate (PubChem CID 71629653) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is tert-butyl 3-(1,3-thiazol-2-ylamino)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(1,3-thiazol-2-ylamino)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71629653 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | tert-butyl 3-(1,3-thiazol-2-ylamino)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2nccs2)C1 |
| InChI | InChI=1S/C12H19N3O2S/c1-12(2,3)17-11(16)15-6-4-9(8-15)14-10-13-5-7-18-10/h5,7,9H,4,6,8H2,1-3H3,(H,13,14) |
| InChIKey | KMNNQBHPDUUCHW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |