C14H21N3O3S — CID 41113080
tert-butyl (3R)-3-(1,3-thiazol-2-ylcarbamoyl)piperidine-1-carboxylate (PubChem CID 41113080) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is tert-butyl (3R)-3-(1,3-thiazol-2-ylcarbamoyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-(1,3-thiazol-2-ylcarbamoyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 41113080 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | tert-butyl (3R)-3-(1,3-thiazol-2-ylcarbamoyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C(=O)Nc2nccs2)C1 |
| InChI | InChI=1S/C14H21N3O3S/c1-14(2,3)20-13(19)17-7-4-5-10(9-17)11(18)16-12-15-6-8-21-12/h6,8,10H,4-5,7,9H2,1-3H3,(H,15,16,18)/t10-/m1/s1 |
| InChIKey | URRDSLMFRDQRBK-SNVBAGLBSA-N |
| XLogP | 2.73 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |