C17H24N2O5S — CID 84554291
tert-butyl 3-[(2-methoxycarbonylthiophen-3-yl)carbamoyl]piperidine-1-carboxylate (PubChem CID 84554291) has the molecular formula C17H24N2O5S and a molecular weight of 368.46 g/mol. Its IUPAC name is tert-butyl 3-[(2-methoxycarbonylthiophen-3-yl)carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(2-methoxycarbonylthiophen-3-yl)carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 84554291 |
| Molecular Formula | C17H24N2O5S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | tert-butyl 3-[(2-methoxycarbonylthiophen-3-yl)carbamoyl]piperidine-1-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)C1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H24N2O5S/c1-17(2,3)24-16(22)19-8-5-6-11(10-19)14(20)18-12-7-9-25-13(12)15(21)23-4/h7,9,11H,5-6,8,10H2,1-4H3,(H,18,20) |
| InChIKey | YJIHHOJCJRXUAR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |