C15H24ClN5O2 — CID 175105607
tert-butyl 3-[[5-chloro-4-(dimethylamino)pyrimidin-2-yl]amino]pyrrolidine-1-carboxylate (PubChem CID 175105607) has the molecular formula C15H24ClN5O2 and a molecular weight of 341.84 g/mol. Its IUPAC name is tert-butyl 3-[[5-chloro-4-(dimethylamino)pyrimidin-2-yl]amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[5-chloro-4-(dimethylamino)pyrimidin-2-yl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 175105607 |
| Molecular Formula | C15H24ClN5O2 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | tert-butyl 3-[[5-chloro-4-(dimethylamino)pyrimidin-2-yl]amino]pyrrolidine-1-carboxylate |
| SMILES | CN(C)c1nc(NC2CCN(C(=O)OC(C)(C)C)C2)ncc1Cl |
| InChI | InChI=1S/C15H24ClN5O2/c1-15(2,3)23-14(22)21-7-6-10(9-21)18-13-17-8-11(16)12(19-13)20(4)5/h8,10H,6-7,9H2,1-5H3,(H,17,18,19) |
| InChIKey | ONEKNJDCOOTFBD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |