C15H19Cl2N3O3 — CID 172648294
tert-butyl 3-[(2,5-dichloropyridine-4-carbonyl)amino]pyrrolidine-1-carboxylate (PubChem CID 172648294) has the molecular formula C15H19Cl2N3O3 and a molecular weight of 360.24 g/mol. Its IUPAC name is tert-butyl 3-[(2,5-dichloropyridine-4-carbonyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(2,5-dichloropyridine-4-carbonyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 172648294 |
| Molecular Formula | C15H19Cl2N3O3 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | tert-butyl 3-[(2,5-dichloropyridine-4-carbonyl)amino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)c2cc(Cl)ncc2Cl)C1 |
| InChI | InChI=1S/C15H19Cl2N3O3/c1-15(2,3)23-14(22)20-5-4-9(8-20)19-13(21)10-6-12(17)18-7-11(10)16/h6-7,9H,4-5,8H2,1-3H3,(H,19,21) |
| InChIKey | BIFHHZKRZWHKIG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|