C20H24N4O3 — CID 122590937
tert-butyl 3-[(5-phenylpyridazine-3-carbonyl)amino]pyrrolidine-1-carboxylate (PubChem CID 122590937) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is tert-butyl 3-[(5-phenylpyridazine-3-carbonyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(5-phenylpyridazine-3-carbonyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 122590937 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | tert-butyl 3-[(5-phenylpyridazine-3-carbonyl)amino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)c2cc(-c3ccccc3)cnn2)C1 |
| InChI | InChI=1S/C20H24N4O3/c1-20(2,3)27-19(26)24-10-9-16(13-24)22-18(25)17-11-15(12-21-23-17)14-7-5-4-6-8-14/h4-8,11-12,16H,9-10,13H2,1-3H3,(H,22,25) |
| InChIKey | ZWRRQYFDFHLGFD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |