C21H26N4O3 — CID 130356629
tert-butyl (3R)-3-[methyl-(5-phenylpyridazin-3-yl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 130356629) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is tert-butyl (3R)-3-[methyl-(5-phenylpyridazin-3-yl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[methyl-(5-phenylpyridazin-3-yl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 130356629 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | tert-butyl (3R)-3-[methyl-(5-phenylpyridazin-3-yl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CN(C(=O)[C@@H]1CCN(C(=O)OC(C)(C)C)C1)c1cc(-c2ccccc2)cnn1 |
| InChI | InChI=1S/C21H26N4O3/c1-21(2,3)28-20(27)25-11-10-16(14-25)19(26)24(4)18-12-17(13-22-23-18)15-8-6-5-7-9-15/h5-9,12-13,16H,10-11,14H2,1-4H3/t16-/m1/s1 |
| InChIKey | COPOYNYYRUUVLQ-MRXNPFEDSA-N |
| XLogP | 3.36 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |