C15H19BrF3N3O2 — CID 170694011
tert-butyl 3-[[6-bromo-4-(trifluoromethyl)-2-pyridinyl]amino]pyrrolidine-1-carboxylate (PubChem CID 170694011) has the molecular formula C15H19BrF3N3O2 and a molecular weight of 410.23 g/mol. Its IUPAC name is tert-butyl 3-[[6-bromo-4-(trifluoromethyl)-2-pyridinyl]amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[6-bromo-4-(trifluoromethyl)-2-pyridinyl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 170694011 |
| Molecular Formula | C15H19BrF3N3O2 |
| Molecular Weight | 410.23 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | tert-butyl 3-[[6-bromo-4-(trifluoromethyl)-2-pyridinyl]amino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2cc(C(F)(F)F)cc(Br)n2)C1 |
| InChI | InChI=1S/C15H19BrF3N3O2/c1-14(2,3)24-13(23)22-5-4-10(8-22)20-12-7-9(15(17,18)19)6-11(16)21-12/h6-7,10H,4-5,8H2,1-3H3,(H,20,21) |
| InChIKey | OAWWISKNFQHRKP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.23 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|