C15H20BrF3N4O2 — CID 166885100
tert-butyl 3-[[6-bromo-5-(trifluoromethyl)pyrazin-2-yl]amino]piperidine-1-carboxylate (PubChem CID 166885100) has the molecular formula C15H20BrF3N4O2 and a molecular weight of 425.25 g/mol. Its IUPAC name is tert-butyl 3-[[6-bromo-5-(trifluoromethyl)pyrazin-2-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[6-bromo-5-(trifluoromethyl)pyrazin-2-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166885100 |
| Molecular Formula | C15H20BrF3N4O2 |
| Molecular Weight | 425.25 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | tert-butyl 3-[[6-bromo-5-(trifluoromethyl)pyrazin-2-yl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(Nc2cnc(C(F)(F)F)c(Br)n2)C1 |
| InChI | InChI=1S/C15H20BrF3N4O2/c1-14(2,3)25-13(24)23-6-4-5-9(8-23)21-10-7-20-11(12(16)22-10)15(17,18)19/h7,9H,4-6,8H2,1-3H3,(H,21,22) |
| InChIKey | NPUAHIWBCDVNCN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.25 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |