C17H22BrF3N2O2 — CID 114042668
tert-butyl 4-[2-bromo-5-(trifluoromethyl)anilino]piperidine-1-carboxylate (PubChem CID 114042668) has the molecular formula C17H22BrF3N2O2 and a molecular weight of 423.27 g/mol. Its IUPAC name is tert-butyl 4-[2-bromo-5-(trifluoromethyl)anilino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-bromo-5-(trifluoromethyl)anilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 114042668 |
| Molecular Formula | C17H22BrF3N2O2 |
| Molecular Weight | 423.27 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | tert-butyl 4-[2-bromo-5-(trifluoromethyl)anilino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2cc(C(F)(F)F)ccc2Br)CC1 |
| InChI | InChI=1S/C17H22BrF3N2O2/c1-16(2,3)25-15(24)23-8-6-12(7-9-23)22-14-10-11(17(19,20)21)4-5-13(14)18/h4-5,10,12,22H,6-9H2,1-3H3 |
| InChIKey | CLWHPMSRWMLAPX-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.27 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |