C14H21BrN4O3 — CID 167350845
tert-butyl 3-[(5-bromo-3-methoxypyrazin-2-yl)amino]pyrrolidine-1-carboxylate (PubChem CID 167350845) has the molecular formula C14H21BrN4O3 and a molecular weight of 373.25 g/mol. Its IUPAC name is tert-butyl 3-[(5-bromo-3-methoxypyrazin-2-yl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(5-bromo-3-methoxypyrazin-2-yl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 167350845 |
| Molecular Formula | C14H21BrN4O3 |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | tert-butyl 3-[(5-bromo-3-methoxypyrazin-2-yl)amino]pyrrolidine-1-carboxylate |
| SMILES | COc1nc(Br)cnc1NC1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H21BrN4O3/c1-14(2,3)22-13(20)19-6-5-9(8-19)17-11-12(21-4)18-10(15)7-16-11/h7,9H,5-6,8H2,1-4H3,(H,16,17) |
| InChIKey | ZWLQVBFXXAAEHA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |