C11H17N5O2 — CID 170364307
1-[(3R)-3-[(5-amino-3-methoxypyrazin-2-yl)amino]pyrrolidin-1-yl]ethanone (PubChem CID 170364307) has the molecular formula C11H17N5O2 and a molecular weight of 251.29 g/mol. Its IUPAC name is 1-[(3R)-3-[(5-amino-3-methoxypyrazin-2-yl)amino]pyrrolidin-1-yl]ethanone.
| Compound Name | 1-[(3R)-3-[(5-amino-3-methoxypyrazin-2-yl)amino]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 170364307 |
| Molecular Formula | C11H17N5O2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 1-[(3R)-3-[(5-amino-3-methoxypyrazin-2-yl)amino]pyrrolidin-1-yl]ethanone |
| SMILES | COc1nc(N)cnc1N[C@@H]1CCN(C(C)=O)C1 |
| InChI | InChI=1S/C11H17N5O2/c1-7(17)16-4-3-8(6-16)14-10-11(18-2)15-9(12)5-13-10/h5,8H,3-4,6H2,1-2H3,(H2,12,15)(H,13,14)/t8-/m1/s1 |
| InChIKey | LGIMZYBDNNUVLS-MRVPVSSYSA-N |
| XLogP | 0.10 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |