C18H22FN3O2 — CID 175301027
tert-butyl 3-[(6-fluoroquinolin-4-yl)amino]pyrrolidine-1-carboxylate (PubChem CID 175301027) has the molecular formula C18H22FN3O2 and a molecular weight of 331.39 g/mol. Its IUPAC name is tert-butyl 3-[(6-fluoroquinolin-4-yl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(6-fluoroquinolin-4-yl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 175301027 |
| Molecular Formula | C18H22FN3O2 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | tert-butyl 3-[(6-fluoroquinolin-4-yl)amino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2ccnc3ccc(F)cc23)C1 |
| InChI | InChI=1S/C18H22FN3O2/c1-18(2,3)24-17(23)22-9-7-13(11-22)21-16-6-8-20-15-5-4-12(19)10-14(15)16/h4-6,8,10,13H,7,9,11H2,1-3H3,(H,20,21) |
| InChIKey | DPGUOSIIIAPMIN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |