C31H32F2N4O3 — CID 121471762
tert-butyl 4-[[6-[bis(4-fluorophenyl)-hydroxymethyl]cinnolin-4-yl]amino]piperidine-1-carboxylate (PubChem CID 121471762) has the molecular formula C31H32F2N4O3 and a molecular weight of 546.62 g/mol. Its IUPAC name is tert-butyl 4-[[6-[bis(4-fluorophenyl)-hydroxymethyl]cinnolin-4-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[6-[bis(4-fluorophenyl)-hydroxymethyl]cinnolin-4-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 121471762 |
| Molecular Formula | C31H32F2N4O3 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | tert-butyl 4-[[6-[bis(4-fluorophenyl)-hydroxymethyl]cinnolin-4-yl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2cnnc3ccc(C(O)(c4ccc(F)cc4)c4ccc(F)cc4)cc23)CC1 |
| InChI | InChI=1S/C31H32F2N4O3/c1-30(2,3)40-29(38)37-16-14-25(15-17-37)35-28-19-34-36-27-13-8-22(18-26(27)28)31(39,20-4-9-23(32)10-5-20)21-6-11-24(33)12-7-21/h4-13,18-19,25,39H,14-17H2,1-3H3,(H,35,36) |
| InChIKey | HVZLICGRIPEHCV-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|