C19H25FN6O2 — CID 90387422
tert-butyl (3S)-3-[[3-[(Z)-C-aminocarbonohydrazonoyl]-7-fluoroisoquinolin-1-yl]amino]pyrrolidine-1-carboxylate (PubChem CID 90387422) has the molecular formula C19H25FN6O2 and a molecular weight of 388.45 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[3-[(Z)-C-aminocarbonohydrazonoyl]-7-fluoroisoquinolin-1-yl]amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[3-[(Z)-C-aminocarbonohydrazonoyl]-7-fluoroisoquinolin-1-yl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90387422 |
| Molecular Formula | C19H25FN6O2 |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | tert-butyl (3S)-3-[[3-[(Z)-C-aminocarbonohydrazonoyl]-7-fluoroisoquinolin-1-yl]amino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](Nc2nc(/C(N)=N/N)cc3ccc(F)cc23)C1 |
| InChI | InChI=1S/C19H25FN6O2/c1-19(2,3)28-18(27)26-7-6-13(10-26)23-17-14-9-12(20)5-4-11(14)8-15(24-17)16(21)25-22/h4-5,8-9,13H,6-7,10,22H2,1-3H3,(H2,21,25)(H,23,24)/t13-/m0/s1 |
| InChIKey | XDLPLMJVBWBXFJ-ZDUSSCGKSA-N |
| XLogP | 2.37 |
| TPSA | 118.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|