C19H24FN5O3 — CID 123271214
tert-butyl 3-[3-[(E)-C-aminocarbonohydrazonoyl]-7-fluoroisoquinolin-1-yl]oxypyrrolidine-1-carboxylate (PubChem CID 123271214) has the molecular formula C19H24FN5O3 and a molecular weight of 389.43 g/mol. Its IUPAC name is tert-butyl 3-[3-[(E)-C-aminocarbonohydrazonoyl]-7-fluoroisoquinolin-1-yl]oxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3-[(E)-C-aminocarbonohydrazonoyl]-7-fluoroisoquinolin-1-yl]oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 123271214 |
| Molecular Formula | C19H24FN5O3 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | tert-butyl 3-[3-[(E)-C-aminocarbonohydrazonoyl]-7-fluoroisoquinolin-1-yl]oxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2nc(/C(N)=N\N)cc3ccc(F)cc23)C1 |
| InChI | InChI=1S/C19H24FN5O3/c1-19(2,3)28-18(26)25-7-6-13(10-25)27-17-14-9-12(20)5-4-11(14)8-15(23-17)16(21)24-22/h4-5,8-9,13H,6-7,10,22H2,1-3H3,(H2,21,24) |
| InChIKey | ZIGJDXIREVNHBV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|