C18H20FN5O3 — CID 169340194
tert-butyl 3-[2-[2-(dicyanomethylidene)hydrazinyl]-4-fluorophenoxy]pyrrolidine-1-carboxylate (PubChem CID 169340194) has the molecular formula C18H20FN5O3 and a molecular weight of 373.39 g/mol. Its IUPAC name is tert-butyl 3-[2-[2-(dicyanomethylidene)hydrazinyl]-4-fluorophenoxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-[2-(dicyanomethylidene)hydrazinyl]-4-fluorophenoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 169340194 |
| Molecular Formula | C18H20FN5O3 |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | tert-butyl 3-[2-[2-(dicyanomethylidene)hydrazinyl]-4-fluorophenoxy]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2ccc(F)cc2NN=C(C#N)C#N)C1 |
| InChI | InChI=1S/C18H20FN5O3/c1-18(2,3)27-17(25)24-7-6-14(11-24)26-16-5-4-12(19)8-15(16)23-22-13(9-20)10-21/h4-5,8,14,23H,6-7,11H2,1-3H3 |
| InChIKey | KCWCDEZTGZNPTR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 110.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|