C17H21FN2O4 — CID 169353985
tert-butyl 4-(4-fluoro-2-isocyanatophenoxy)piperidine-1-carboxylate (PubChem CID 169353985) has the molecular formula C17H21FN2O4 and a molecular weight of 336.36 g/mol. Its IUPAC name is tert-butyl 4-(4-fluoro-2-isocyanatophenoxy)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-fluoro-2-isocyanatophenoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169353985 |
| Molecular Formula | C17H21FN2O4 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | tert-butyl 4-(4-fluoro-2-isocyanatophenoxy)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2ccc(F)cc2N=C=O)CC1 |
| InChI | InChI=1S/C17H21FN2O4/c1-17(2,3)24-16(22)20-8-6-13(7-9-20)23-15-5-4-12(18)10-14(15)19-11-21/h4-5,10,13H,6-9H2,1-3H3 |
| InChIKey | SNQCRFIZQMCAAQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|