C25H29N3O3 — CID 175301037
tert-butyl 3-[(8-phenylmethoxyquinolin-5-yl)amino]pyrrolidine-1-carboxylate (PubChem CID 175301037) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is tert-butyl 3-[(8-phenylmethoxyquinolin-5-yl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(8-phenylmethoxyquinolin-5-yl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 175301037 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | tert-butyl 3-[(8-phenylmethoxyquinolin-5-yl)amino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2ccc(OCc3ccccc3)c3ncccc23)C1 |
| InChI | InChI=1S/C25H29N3O3/c1-25(2,3)31-24(29)28-15-13-19(16-28)27-21-11-12-22(23-20(21)10-7-14-26-23)30-17-18-8-5-4-6-9-18/h4-12,14,19,27H,13,15-17H2,1-3H3 |
| InChIKey | JQUTZLCMCPPYLW-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|