C26H30N2O5S — CID 122441955
tert-butyl 4-(8-phenylmethoxyquinolin-5-yl)sulfonylpiperidine-1-carboxylate (PubChem CID 122441955) has the molecular formula C26H30N2O5S and a molecular weight of 482.60 g/mol. Its IUPAC name is tert-butyl 4-(8-phenylmethoxyquinolin-5-yl)sulfonylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(8-phenylmethoxyquinolin-5-yl)sulfonylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 122441955 |
| Molecular Formula | C26H30N2O5S |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | tert-butyl 4-(8-phenylmethoxyquinolin-5-yl)sulfonylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(S(=O)(=O)c2ccc(OCc3ccccc3)c3ncccc23)CC1 |
| InChI | InChI=1S/C26H30N2O5S/c1-26(2,3)33-25(29)28-16-13-20(14-17-28)34(30,31)23-12-11-22(24-21(23)10-7-15-27-24)32-18-19-8-5-4-6-9-19/h4-12,15,20H,13-14,16-18H2,1-3H3 |
| InChIKey | WFWFCTFWPVWHMC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |