C24H27N5O3 — CID 175300892
tert-butyl 3-[[8-(pyridin-4-ylcarbamoyl)quinolin-5-yl]amino]pyrrolidine-1-carboxylate (PubChem CID 175300892) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is tert-butyl 3-[[8-(pyridin-4-ylcarbamoyl)quinolin-5-yl]amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[8-(pyridin-4-ylcarbamoyl)quinolin-5-yl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 175300892 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | tert-butyl 3-[[8-(pyridin-4-ylcarbamoyl)quinolin-5-yl]amino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2ccc(C(=O)Nc3ccncc3)c3ncccc23)C1 |
| InChI | InChI=1S/C24H27N5O3/c1-24(2,3)32-23(31)29-14-10-17(15-29)27-20-7-6-19(21-18(20)5-4-11-26-21)22(30)28-16-8-12-25-13-9-16/h4-9,11-13,17,27H,10,14-15H2,1-3H3,(H,25,28,30) |
| InChIKey | UOGYJGHTCKGQCV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |