C19H23ClN2O3 — CID 100782715
3-(4-chlorophenyl)-N-[6-(2-methoxyethoxy)-3-pyridinyl]-2,2-dimethylpropanamide (PubChem CID 100782715) has the molecular formula C19H23ClN2O3 and a molecular weight of 362.86 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[6-(2-methoxyethoxy)-3-pyridinyl]-2,2-dimethylpropanamide.
| Compound Name | 3-(4-chlorophenyl)-N-[6-(2-methoxyethoxy)-3-pyridinyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 100782715 |
| Molecular Formula | C19H23ClN2O3 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[6-(2-methoxyethoxy)-3-pyridinyl]-2,2-dimethylpropanamide |
| SMILES | COCCOc1ccc(NC(=O)C(C)(C)Cc2ccc(Cl)cc2)cn1 |
| InChI | InChI=1S/C19H23ClN2O3/c1-19(2,12-14-4-6-15(20)7-5-14)18(23)22-16-8-9-17(21-13-16)25-11-10-24-3/h4-9,13H,10-12H2,1-3H3,(H,22,23) |
| InChIKey | SRWLBIJJTBHFPG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|