C18H30N2O4 — CID 133205857
N-[6-(2-methoxyethoxy)-3-pyridinyl]-2,4-dimethyl-2-propoxypentanamide (PubChem CID 133205857) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is N-[6-(2-methoxyethoxy)-3-pyridinyl]-2,4-dimethyl-2-propoxypentanamide.
| Compound Name | N-[6-(2-methoxyethoxy)-3-pyridinyl]-2,4-dimethyl-2-propoxypentanamide |
|---|---|
| PubChem CID | 133205857 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | N-[6-(2-methoxyethoxy)-3-pyridinyl]-2,4-dimethyl-2-propoxypentanamide |
| SMILES | CCCOC(C)(CC(C)C)C(=O)Nc1ccc(OCCOC)nc1 |
| InChI | InChI=1S/C18H30N2O4/c1-6-9-24-18(4,12-14(2)3)17(21)20-15-7-8-16(19-13-15)23-11-10-22-5/h7-8,13-14H,6,9-12H2,1-5H3,(H,20,21) |
| InChIKey | UELHDQGWFMYZOS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|