C18H30N2O3 — CID 133205914
2-methyl-2-propoxy-N-(6-propoxy-3-pyridinyl)hexanamide (PubChem CID 133205914) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is 2-methyl-2-propoxy-N-(6-propoxy-3-pyridinyl)hexanamide.
| Compound Name | 2-methyl-2-propoxy-N-(6-propoxy-3-pyridinyl)hexanamide |
|---|---|
| PubChem CID | 133205914 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 2-methyl-2-propoxy-N-(6-propoxy-3-pyridinyl)hexanamide |
| SMILES | CCCCC(C)(OCCC)C(=O)Nc1ccc(OCCC)nc1 |
| InChI | InChI=1S/C18H30N2O3/c1-5-8-11-18(4,23-13-7-3)17(21)20-15-9-10-16(19-14-15)22-12-6-2/h9-10,14H,5-8,11-13H2,1-4H3,(H,20,21) |
| InChIKey | CYBQWHQTWIYWGC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |