C18H30N2O3 — CID 100776618
(2S)-N-(6-butoxy-3-pyridinyl)-2-ethoxy-2-methylhexanamide (PubChem CID 100776618) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is (2S)-N-(6-butoxy-3-pyridinyl)-2-ethoxy-2-methylhexanamide.
| Compound Name | (2S)-N-(6-butoxy-3-pyridinyl)-2-ethoxy-2-methylhexanamide |
|---|---|
| PubChem CID | 100776618 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (2S)-N-(6-butoxy-3-pyridinyl)-2-ethoxy-2-methylhexanamide |
| SMILES | CCCCOc1ccc(NC(=O)[C@](C)(CCCC)OCC)cn1 |
| InChI | InChI=1S/C18H30N2O3/c1-5-8-12-18(4,23-7-3)17(21)20-15-10-11-16(19-14-15)22-13-9-6-2/h10-11,14H,5-9,12-13H2,1-4H3,(H,20,21)/t18-/m0/s1 |
| InChIKey | OSSFXJCSCLQQQC-SFHVURJKSA-N |
| XLogP | 4.18 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|