C20H34N2O4 — CID 133205941
N-[6-(2-ethoxyethoxy)-3-pyridinyl]-2-methyl-2-propoxyheptanamide (PubChem CID 133205941) has the molecular formula C20H34N2O4 and a molecular weight of 366.50 g/mol. Its IUPAC name is N-[6-(2-ethoxyethoxy)-3-pyridinyl]-2-methyl-2-propoxyheptanamide.
| Compound Name | N-[6-(2-ethoxyethoxy)-3-pyridinyl]-2-methyl-2-propoxyheptanamide |
|---|---|
| PubChem CID | 133205941 |
| Molecular Formula | C20H34N2O4 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | N-[6-(2-ethoxyethoxy)-3-pyridinyl]-2-methyl-2-propoxyheptanamide |
| SMILES | CCCCCC(C)(OCCC)C(=O)Nc1ccc(OCCOCC)nc1 |
| InChI | InChI=1S/C20H34N2O4/c1-5-8-9-12-20(4,26-13-6-2)19(23)22-17-10-11-18(21-16-17)25-15-14-24-7-3/h10-11,16H,5-9,12-15H2,1-4H3,(H,22,23) |
| InChIKey | IBXVBAVKYOIEAZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|