C14H24N2O2 — CID 62950387
N-(3,3-dimethylbutyl)-6-(2-methoxyethoxy)pyridin-3-amine (PubChem CID 62950387) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-6-(2-methoxyethoxy)pyridin-3-amine.
| Compound Name | N-(3,3-dimethylbutyl)-6-(2-methoxyethoxy)pyridin-3-amine |
|---|---|
| PubChem CID | 62950387 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | N-(3,3-dimethylbutyl)-6-(2-methoxyethoxy)pyridin-3-amine |
| SMILES | COCCOc1ccc(NCCC(C)(C)C)cn1 |
| InChI | InChI=1S/C14H24N2O2/c1-14(2,3)7-8-15-12-5-6-13(16-11-12)18-10-9-17-4/h5-6,11,15H,7-10H2,1-4H3 |
| InChIKey | PVUVNBSXTRYTRB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|