C14H25N3O2 — CID 107444977
N'-tert-butyl-N-[6-(2-methoxyethoxy)-3-pyridinyl]ethane-1,2-diamine (PubChem CID 107444977) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is N'-tert-butyl-N-[6-(2-methoxyethoxy)-3-pyridinyl]ethane-1,2-diamine.
| Compound Name | N'-tert-butyl-N-[6-(2-methoxyethoxy)-3-pyridinyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 107444977 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | N'-tert-butyl-N-[6-(2-methoxyethoxy)-3-pyridinyl]ethane-1,2-diamine |
| SMILES | COCCOc1ccc(NCCNC(C)(C)C)cn1 |
| InChI | InChI=1S/C14H25N3O2/c1-14(2,3)17-8-7-15-12-5-6-13(16-11-12)19-10-9-18-4/h5-6,11,15,17H,7-10H2,1-4H3 |
| InChIKey | SDWJRDIIHKIEIQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|