C11H14N4O2S — CID 43688430
6-(2-methoxyethoxy)-N-(thiadiazol-4-ylmethyl)pyridin-3-amine (PubChem CID 43688430) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is 6-(2-methoxyethoxy)-N-(thiadiazol-4-ylmethyl)pyridin-3-amine.
| Compound Name | 6-(2-methoxyethoxy)-N-(thiadiazol-4-ylmethyl)pyridin-3-amine |
|---|---|
| PubChem CID | 43688430 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 6-(2-methoxyethoxy)-N-(thiadiazol-4-ylmethyl)pyridin-3-amine |
| SMILES | COCCOc1ccc(NCc2csnn2)cn1 |
| InChI | InChI=1S/C11H14N4O2S/c1-16-4-5-17-11-3-2-9(6-13-11)12-7-10-8-18-15-14-10/h2-3,6,8,12H,4-5,7H2,1H3 |
| InChIKey | PHELKTFAKJBJMO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|