About 2-N,2-N-dimethyl-5-N-(thiadiazol-4-ylmethyl)pyridine-2,5-diamine
2-N,2-N-dimethyl-5-N-(thiadiazol-4-ylmethyl)pyridine-2,5-diamine (PubChem CID 43690649) has the molecular formula C10H13N5S
and a molecular weight of 235.32 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-5-N-(thiadiazol-4-ylmethyl)pyridine-2,5-diamine.
Molecular Properties
| Compound Name | 2-N,2-N-dimethyl-5-N-(thiadiazol-4-ylmethyl)pyridine-2,5-diamine |
| PubChem CID | 43690649 |
| Molecular Formula | C10H13N5S |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 2-N,2-N-dimethyl-5-N-(thiadiazol-4-ylmethyl)pyridine-2,5-diamine |
| SMILES | CN(C)c1ccc(NCc2csnn2)cn1 |
| InChI | InChI=1S/C10H13N5S/c1-15(2)10-4-3-8(5-12-10)11-6-9-7-16-14-13-9/h3-5,7,11H,6H2,1-2H3 |
| InChIKey | JIOOWOJJQYENFW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-N,2-N-dimethyl-5-N-(thiadiazol-4-ylmethyl)pyridine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,2-N-dimethyl-5-N-(thiadiazol-4-ylmethyl)pyridine-2,5-diamine?
The IUPAC name of 2-N,2-N-dimethyl-5-N-(thiadiazol-4-ylmethyl)pyridine-2,5-diamine (CID 43690649) is 2-N,2-N-dimethyl-5-N-(thiadiazol-4-ylmethyl)pyridine-2,5-diamine.
What is the SMILES notation for 2-N,2-N-dimethyl-5-N-(thiadiazol-4-ylmethyl)pyridine-2,5-diamine?
The canonical SMILES for 2-N,2-N-dimethyl-5-N-(thiadiazol-4-ylmethyl)pyridine-2,5-diamine is CN(C)c1ccc(NCc2csnn2)cn1.
What is the InChIKey of 2-N,2-N-dimethyl-5-N-(thiadiazol-4-ylmethyl)pyridine-2,5-diamine?
The InChIKey is JIOOWOJJQYENFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N5S/c1-15(2)10-4-3-8(5-12-10)11-6-9-7-16-14-13-9/h3-5,7,11H,6H2,1-2H3.
What are the key properties of 2-N,2-N-dimethyl-5-N-(thiadiazol-4-ylmethyl)pyridine-2,5-diamine?
2-N,2-N-dimethyl-5-N-(thiadiazol-4-ylmethyl)pyridine-2,5-diamine has a molecular weight of 235.32 g/mol, XLogP of 1.61, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,2-N-dimethyl-5-N-(thiadiazol-4-ylmethyl)pyridine-2,5-diamine is sourced from PubChem (CID 43690649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).